C11H18O2 — CID 11745263
(1S,2S,6S,7S)-6-methyltricyclo[4.4.0.02,7]decane-1,2-diol (PubChem CID 11745263) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (1S,2S,6S,7S)-6-methyltricyclo[4.4.0.02,7]decane-1,2-diol.
| Compound Name | (1S,2S,6S,7S)-6-methyltricyclo[4.4.0.02,7]decane-1,2-diol |
|---|---|
| PubChem CID | 11745263 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (1S,2S,6S,7S)-6-methyltricyclo[4.4.0.02,7]decane-1,2-diol |
| SMILES | C[C@]12CCC[C@]3(O)[C@H]1CCC[C@]23O |
| InChI | InChI=1S/C11H18O2/c1-9-5-3-6-10(12)8(9)4-2-7-11(9,10)13/h8,12-13H,2-7H2,1H3/t8-,9-,10-,11-/m0/s1 |
| InChIKey | MTFVMPGFOYKLNM-NAKRPEOUSA-N |
| XLogP | 1.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |