C15H24O2 — CID 10988274
(1S,3R,4S,6R,7R,8R)-4,8,12,12-tetramethyl-5-oxatetracyclo[6.4.0.01,3.04,6]dodecan-7-ol (PubChem CID 10988274) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (1S,3R,4S,6R,7R,8R)-4,8,12,12-tetramethyl-5-oxatetracyclo[6.4.0.01,3.04,6]dodecan-7-ol.
| Compound Name | (1S,3R,4S,6R,7R,8R)-4,8,12,12-tetramethyl-5-oxatetracyclo[6.4.0.01,3.04,6]dodecan-7-ol |
|---|---|
| PubChem CID | 10988274 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1S,3R,4S,6R,7R,8R)-4,8,12,12-tetramethyl-5-oxatetracyclo[6.4.0.01,3.04,6]dodecan-7-ol |
| SMILES | CC1(C)CCC[C@@]2(C)[C@@H](O)[C@H]3O[C@@]3(C)[C@@H]3C[C@]312 |
| InChI | InChI=1S/C15H24O2/c1-12(2)6-5-7-13(3)10(16)11-14(4,17-11)9-8-15(9,12)13/h9-11,16H,5-8H2,1-4H3/t9-,10-,11+,13-,14-,15-/m0/s1 |
| InChIKey | HLCSLDGZDJOUEF-ZFMHXWJXSA-N |
| XLogP | 2.74 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|