C14H22O2 — CID 15546633
(1R,6R,7S,11S)-11-hydroxy-2,2,6-trimethyltricyclo[5.2.2.01,6]undecan-9-one (PubChem CID 15546633) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (1R,6R,7S,11S)-11-hydroxy-2,2,6-trimethyltricyclo[5.2.2.01,6]undecan-9-one.
| Compound Name | (1R,6R,7S,11S)-11-hydroxy-2,2,6-trimethyltricyclo[5.2.2.01,6]undecan-9-one |
|---|---|
| PubChem CID | 15546633 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (1R,6R,7S,11S)-11-hydroxy-2,2,6-trimethyltricyclo[5.2.2.01,6]undecan-9-one |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H]3CC(=O)[C@]12C[C@@H]3O |
| InChI | InChI=1S/C14H22O2/c1-12(2)5-4-6-13(3)9-7-11(16)14(12,13)8-10(9)15/h9-10,15H,4-8H2,1-3H3/t9-,10+,13-,14-/m1/s1 |
| InChIKey | UWCLTLUJLPJWOL-RDBQEKCUSA-N |
| XLogP | 2.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |