C13H20O — CID 135020031
(1aR,3aS,7aR)-3a,4,4-trimethyl-1,1a,2,5,6,7-hexahydrocyclopropa[c]inden-3-one (PubChem CID 135020031) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (1aR,3aS,7aR)-3a,4,4-trimethyl-1,1a,2,5,6,7-hexahydrocyclopropa[c]inden-3-one.
| Compound Name | (1aR,3aS,7aR)-3a,4,4-trimethyl-1,1a,2,5,6,7-hexahydrocyclopropa[c]inden-3-one |
|---|---|
| PubChem CID | 135020031 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (1aR,3aS,7aR)-3a,4,4-trimethyl-1,1a,2,5,6,7-hexahydrocyclopropa[c]inden-3-one |
| SMILES | CC1(C)CCC[C@@]23C[C@@H]2CC(=O)[C@@]13C |
| InChI | InChI=1S/C13H20O/c1-11(2)5-4-6-13-8-9(13)7-10(14)12(11,13)3/h9H,4-8H2,1-3H3/t9-,12-,13+/m0/s1 |
| InChIKey | LYTLPJDCGQZIQF-TVYUQYBPSA-N |
| XLogP | 3.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |