C15H24O5 — CID 101169343
(1aR,2S,3S,4R,4aR,8aS)-2,3-dihydroxy-3,4a,8,8-tetramethyl-1a,2,4,5,6,7-hexahydronaphtho[4,4a-b]oxirene-4-carboxylic acid (PubChem CID 101169343) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is (1aR,2S,3S,4R,4aR,8aS)-2,3-dihydroxy-3,4a,8,8-tetramethyl-1a,2,4,5,6,7-hexahydronaphtho[4,4a-b]oxirene-4-carboxylic acid.
| Compound Name | (1aR,2S,3S,4R,4aR,8aS)-2,3-dihydroxy-3,4a,8,8-tetramethyl-1a,2,4,5,6,7-hexahydronaphtho[4,4a-b]oxirene-4-carboxylic acid |
|---|---|
| PubChem CID | 101169343 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (1aR,2S,3S,4R,4aR,8aS)-2,3-dihydroxy-3,4a,8,8-tetramethyl-1a,2,4,5,6,7-hexahydronaphtho[4,4a-b]oxirene-4-carboxylic acid |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H](C(=O)O)[C@](C)(O)[C@@H](O)[C@H]3O[C@@]312 |
| InChI | InChI=1S/C15H24O5/c1-12(2)6-5-7-13(3)8(11(17)18)14(4,19)9(16)10-15(12,13)20-10/h8-10,16,19H,5-7H2,1-4H3,(H,17,18)/t8-,9+,10-,13-,14+,15+/m1/s1 |
| InChIKey | GKVUZACNCGFJIR-OTSMLXFPSA-N |
| XLogP | 1.17 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|