C21H30O6 — CID 98477471
methyl (1S,2R,6R,7R,9R,11R,12R,13R,15R,16R)-12-hydroxy-2,6-dimethyl-13-propan-2-yl-10,14,17-trioxahexacyclo[9.6.0.01,16.02,7.09,11.013,15]heptadecane-6-carboxylate (PubChem CID 98477471) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is methyl (1S,2R,6R,7R,9R,11R,12R,13R,15R,16R)-12-hydroxy-2,6-dimethyl-13-propan-2-yl-10,14,17-trioxahexacyclo[9.6.0.01,16.02,7.09,11.013,15]heptadecane-6-carboxylate.
| Compound Name | methyl (1S,2R,6R,7R,9R,11R,12R,13R,15R,16R)-12-hydroxy-2,6-dimethyl-13-propan-2-yl-10,14,17-trioxahexacyclo[9.6.0.01,16.02,7.09,11.013,15]heptadecane-6-carboxylate |
|---|---|
| PubChem CID | 98477471 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | methyl (1S,2R,6R,7R,9R,11R,12R,13R,15R,16R)-12-hydroxy-2,6-dimethyl-13-propan-2-yl-10,14,17-trioxahexacyclo[9.6.0.01,16.02,7.09,11.013,15]heptadecane-6-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@]2(C)[C@H]1C[C@H]1O[C@]13[C@H](O)[C@@]1(C(C)C)O[C@@H]1[C@H]1O[C@@]132 |
| InChI | InChI=1S/C21H30O6/c1-10(2)19-13(26-19)14-21(27-14)18(4)8-6-7-17(3,16(23)24-5)11(18)9-12-20(21,25-12)15(19)22/h10-15,22H,6-9H2,1-5H3/t11-,12+,13+,14+,15+,17+,18+,19-,20-,21+/m0/s1 |
| InChIKey | PIVVALPOKVQKHY-ACDFAPADSA-N |
| XLogP | 1.82 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|