C27H28O7 — CID 59638625
(1S,2S,4S,5S,7R,8R,9S,11S,13S)-15-benzoyl-8-hydroxy-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one (PubChem CID 59638625) has the molecular formula C27H28O7 and a molecular weight of 464.51 g/mol. Its IUPAC name is (1S,2S,4S,5S,7R,8R,9S,11S,13S)-15-benzoyl-8-hydroxy-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one.
| Compound Name | (1S,2S,4S,5S,7R,8R,9S,11S,13S)-15-benzoyl-8-hydroxy-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one |
|---|---|
| PubChem CID | 59638625 |
| Molecular Formula | C27H28O7 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | (1S,2S,4S,5S,7R,8R,9S,11S,13S)-15-benzoyl-8-hydroxy-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one |
| SMILES | CC(C)[C@]12O[C@H]1[C@@H]1O[C@]13[C@]1(O[C@H]1C[C@H]1C4=C(CC[C@@]13C)C(=O)OC4C(=O)c1ccccc1)[C@@H]2O |
| InChI | InChI=1S/C27H28O7/c1-12(2)25-20(33-25)21-27(34-21)24(3)10-9-14-17(15(24)11-16-26(27,32-16)23(25)30)19(31-22(14)29)18(28)13-7-5-4-6-8-13/h4-8,12,15-16,19-21,23,30H,9-11H2,1-3H3/t15-,16-,19?,20-,21-,23+,24-,25-,26+,27+/m0/s1 |
| InChIKey | AJHFKOYXGOQYCC-MUINJHHESA-N |
| XLogP | 2.35 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|