C20H23Na2O9P — CID 58645454
disodium;[(1S,2S,5S,7S,8R,9R,11S,13S)-1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl] phosphate (PubChem CID 58645454) has the molecular formula C20H23Na2O9P and a molecular weight of 484.35 g/mol. Its IUPAC name is disodium;[(1S,2S,5S,7S,8R,9R,11S,13S)-1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl] phosphate.
| Compound Name | disodium;[(1S,2S,5S,7S,8R,9R,11S,13S)-1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl] phosphate |
|---|---|
| PubChem CID | 58645454 |
| Molecular Formula | C20H23Na2O9P |
| Molecular Weight | 484.35 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | disodium;[(1S,2S,5S,7S,8R,9R,11S,13S)-1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl] phosphate |
| SMILES | CC(C)[C@]12O[C@H]1C1O[C@]13[C@]1(O[C@H]1C[C@H]1C4=C(CC[C@@]13C)C(=O)OC4)[C@@H]2OP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C20H25O9P.2Na/c1-8(2)18-13(27-18)14-20(28-14)17(3)5-4-9-10(7-25-15(9)21)11(17)6-12-19(20,26-12)16(18)29-30(22,23)24;;/h8,11-14,16H,4-7H2,1-3H3,(H2,22,23,24);;/q;2*+1/p-2/t11-,12-,13-,14?,16+,17-,18-,19+,20+;;/m0../s1 |
| InChIKey | MQJAIWJKONRLQK-AHDNJEKHSA-L |
| XLogP | -6.04 |
| TPSA | 136.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.35 |
| LogP ≤ 5 | -6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|