C21H37NO2 — CID 171802583
methyl (4aS)-4b-amino-1,4a-dimethyl-7-propan-2-yl-3,4,5,6,7,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate (PubChem CID 171802583) has the molecular formula C21H37NO2 and a molecular weight of 335.53 g/mol. Its IUPAC name is methyl (4aS)-4b-amino-1,4a-dimethyl-7-propan-2-yl-3,4,5,6,7,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | methyl (4aS)-4b-amino-1,4a-dimethyl-7-propan-2-yl-3,4,5,6,7,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 171802583 |
| Molecular Formula | C21H37NO2 |
| Molecular Weight | 335.53 g/mol |
| Exact Mass | 335.28 |
| IUPAC Name | methyl (4aS)-4b-amino-1,4a-dimethyl-7-propan-2-yl-3,4,5,6,7,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate |
| SMILES | COC(=O)C1(C)CCC[C@@]2(C)C1CCC1CC(C(C)C)CCC12N |
| InChI | InChI=1S/C21H37NO2/c1-14(2)15-9-12-21(22)16(13-15)7-8-17-19(3,18(23)24-5)10-6-11-20(17,21)4/h14-17H,6-13,22H2,1-5H3/t15?,16?,17?,19?,20-,21?/m0/s1 |
| InChIKey | XTEKYGUYGFVWHN-WUYDXNIYSA-N |
| XLogP | 4.54 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |