C29H40O4 — CID 40914292
methyl (1S,4R,5R,9R,10S,12S)-14,17-dimethoxy-5,9-dimethyl-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icosa-13,15,17,19-tetraene-5-carboxylate (PubChem CID 40914292) has the molecular formula C29H40O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is methyl (1S,4R,5R,9R,10S,12S)-14,17-dimethoxy-5,9-dimethyl-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icosa-13,15,17,19-tetraene-5-carboxylate.
| Compound Name | methyl (1S,4R,5R,9R,10S,12S)-14,17-dimethoxy-5,9-dimethyl-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icosa-13,15,17,19-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 40914292 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | methyl (1S,4R,5R,9R,10S,12S)-14,17-dimethoxy-5,9-dimethyl-20-propan-2-ylpentacyclo[10.6.2.01,10.04,9.013,18]icosa-13,15,17,19-tetraene-5-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)[C@H]1CC[C@]13C=C(C(C)C)[C@H](C[C@@H]21)c1c(OC)ccc(OC)c13 |
| InChI | InChI=1S/C29H40O4/c1-17(2)19-16-29-14-11-22-27(3,12-8-13-28(22,4)26(30)33-7)23(29)15-18(19)24-20(31-5)9-10-21(32-6)25(24)29/h9-10,16-18,22-23H,8,11-15H2,1-7H3/t18-,22+,23-,27-,28+,29-/m0/s1 |
| InChIKey | RBBZVTLSFMUCIE-YKKWBHGESA-N |
| XLogP | 6.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|