C22H32O3 — CID 101114883
(1S,4S,9S,10R,12S)-5,5,9-trimethyl-17-propan-2-yl-14-oxatetracyclo[10.3.2.01,10.04,9]heptadec-16-ene-13,15-dione (PubChem CID 101114883) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (1S,4S,9S,10R,12S)-5,5,9-trimethyl-17-propan-2-yl-14-oxatetracyclo[10.3.2.01,10.04,9]heptadec-16-ene-13,15-dione.
| Compound Name | (1S,4S,9S,10R,12S)-5,5,9-trimethyl-17-propan-2-yl-14-oxatetracyclo[10.3.2.01,10.04,9]heptadec-16-ene-13,15-dione |
|---|---|
| PubChem CID | 101114883 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (1S,4S,9S,10R,12S)-5,5,9-trimethyl-17-propan-2-yl-14-oxatetracyclo[10.3.2.01,10.04,9]heptadec-16-ene-13,15-dione |
| SMILES | CC(C)C1=C[C@@]23CC[C@H]4C(C)(C)CCC[C@]4(C)[C@H]2C[C@@H]1C(=O)OC3=O |
| InChI | InChI=1S/C22H32O3/c1-13(2)15-12-22-10-7-16-20(3,4)8-6-9-21(16,5)17(22)11-14(15)18(23)25-19(22)24/h12-14,16-17H,6-11H2,1-5H3/t14-,16-,17+,21-,22-/m0/s1 |
| InChIKey | JEYPDCLTJQOAHT-WOIVNALZSA-N |
| XLogP | 4.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|