C20H30O — CID 135067288
(4S,10R)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-en-16-one (PubChem CID 135067288) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (4S,10R)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-en-16-one.
| Compound Name | (4S,10R)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-en-16-one |
|---|---|
| PubChem CID | 135067288 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (4S,10R)-5,5,9,14-tetramethyltetracyclo[11.2.1.01,10.04,9]hexadec-14-en-16-one |
| SMILES | CC1=CC23CC[C@H]4C(C)(C)CCCC4(C)[C@H]2CCC1C3=O |
| InChI | InChI=1S/C20H30O/c1-13-12-20-11-8-15-18(2,3)9-5-10-19(15,4)16(20)7-6-14(13)17(20)21/h12,14-16H,5-11H2,1-4H3/t14?,15-,16+,19?,20?/m0/s1 |
| InChIKey | DQPXOGBNWPGKBU-FHIIMIHHSA-N |
| XLogP | 5.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|