About 1,5,5,7-tetramethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-ol
1,5,5,7-tetramethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-ol (PubChem CID 15051539) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is 1,5,5,7-tetramethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-ol.
Analyze 1,5,5,7-tetramethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5,5,7-tetramethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-ol?
The IUPAC name of 1,5,5,7-tetramethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-ol (CID 15051539) is 1,5,5,7-tetramethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-ol.
What is the SMILES notation for 1,5,5,7-tetramethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-ol?
The canonical SMILES for 1,5,5,7-tetramethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-ol is CC1(C)OC2C(O)C3(C)CC1C2(C)O3.
What is the InChIKey of 1,5,5,7-tetramethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-ol?
The InChIKey is VFYYMDURPXBRLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3/c1-9(2)6-5-10(3)7(12)8(13-9)11(6,4)14-10/h6-8,12H,5H2,1-4H3.
What are the key properties of 1,5,5,7-tetramethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-ol?
1,5,5,7-tetramethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-ol has a molecular weight of 198.26 g/mol, XLogP of 1.09, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5,5,7-tetramethyl-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-ol is sourced from PubChem (CID 15051539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).