C10H16O4 — CID 177442847
(1R,3S,4S,6S,8R,9R)-4-methoxy-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-9-ol (PubChem CID 177442847) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (1R,3S,4S,6S,8R,9R)-4-methoxy-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-9-ol.
| Compound Name | (1R,3S,4S,6S,8R,9R)-4-methoxy-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-9-ol |
|---|---|
| PubChem CID | 177442847 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (1R,3S,4S,6S,8R,9R)-4-methoxy-6,8-dimethyl-2,7-dioxatricyclo[4.2.1.03,8]nonan-9-ol |
| SMILES | CO[C@H]1C[C@]2(C)O[C@]3(C)[C@H](O[C@@H]13)[C@H]2O |
| InChI | InChI=1S/C10H16O4/c1-9-4-5(12-3)7-10(2,14-9)8(13-7)6(9)11/h5-8,11H,4H2,1-3H3/t5-,6+,7-,8+,9-,10-/m0/s1 |
| InChIKey | IGJBMVPAZZXWNW-UFMRAMJRSA-N |
| XLogP | 0.08 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |