C10H16O2 — CID 130145168
4,8,8-trimethyl-3-oxatricyclo[5.1.0.02,4]octan-5-ol (PubChem CID 130145168) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 4,8,8-trimethyl-3-oxatricyclo[5.1.0.02,4]octan-5-ol.
| Compound Name | 4,8,8-trimethyl-3-oxatricyclo[5.1.0.02,4]octan-5-ol |
|---|---|
| PubChem CID | 130145168 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 4,8,8-trimethyl-3-oxatricyclo[5.1.0.02,4]octan-5-ol |
| SMILES | CC1(C)C2CC(O)C3(C)OC3C21 |
| InChI | InChI=1S/C10H16O2/c1-9(2)5-4-6(11)10(3)8(12-10)7(5)9/h5-8,11H,4H2,1-3H3 |
| InChIKey | LOHCFRDCTDPSPG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|