C12H18O3 — CID 23268321
[(1S,2R,3R,5R,7R)-3,8,8-trimethyl-4-oxatricyclo[5.1.0.03,5]octan-2-yl] acetate (PubChem CID 23268321) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is [(1S,2R,3R,5R,7R)-3,8,8-trimethyl-4-oxatricyclo[5.1.0.03,5]octan-2-yl] acetate.
| Compound Name | [(1S,2R,3R,5R,7R)-3,8,8-trimethyl-4-oxatricyclo[5.1.0.03,5]octan-2-yl] acetate |
|---|---|
| PubChem CID | 23268321 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | [(1S,2R,3R,5R,7R)-3,8,8-trimethyl-4-oxatricyclo[5.1.0.03,5]octan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2[C@@H](C[C@H]3O[C@@]13C)C2(C)C |
| InChI | InChI=1S/C12H18O3/c1-6(13)14-10-9-7(11(9,2)3)5-8-12(10,4)15-8/h7-10H,5H2,1-4H3/t7-,8-,9-,10-,12-/m1/s1 |
| InChIKey | VDMWHKXUDBCGIA-SANCVJEGSA-N |
| XLogP | 1.75 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|