C17H22O11 — CID 92537479
[(4S,5R,7R,8R)-4,5,7,8-tetraacetyloxy-1-oxaspiro[2.5]octan-6-yl] acetate (PubChem CID 92537479) has the molecular formula C17H22O11 and a molecular weight of 402.35 g/mol. Its IUPAC name is [(4S,5R,7R,8R)-4,5,7,8-tetraacetyloxy-1-oxaspiro[2.5]octan-6-yl] acetate.
| Compound Name | [(4S,5R,7R,8R)-4,5,7,8-tetraacetyloxy-1-oxaspiro[2.5]octan-6-yl] acetate |
|---|---|
| PubChem CID | 92537479 |
| Molecular Formula | C17H22O11 |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | [(4S,5R,7R,8R)-4,5,7,8-tetraacetyloxy-1-oxaspiro[2.5]octan-6-yl] acetate |
| SMILES | CC(=O)OC1[C@@H](OC(C)=O)[C@@H](OC(C)=O)C2(CO2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H22O11/c1-7(18)24-12-13(25-8(2)19)15(27-10(4)21)17(6-23-17)16(28-11(5)22)14(12)26-9(3)20/h12-16H,6H2,1-5H3/t12?,13-,14-,15-,16+,17?/m1/s1 |
| InChIKey | XVEACTPJNKPHGA-DITZSBANSA-N |
| XLogP | -0.57 |
| TPSA | 144.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|