C10H16O8 — CID 91125579
[(2R,3S,4S,6R)-4-acetyloxy-5,5,6-trihydroxy-2-methyloxan-3-yl] acetate (PubChem CID 91125579) has the molecular formula C10H16O8 and a molecular weight of 264.23 g/mol. Its IUPAC name is [(2R,3S,4S,6R)-4-acetyloxy-5,5,6-trihydroxy-2-methyloxan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,6R)-4-acetyloxy-5,5,6-trihydroxy-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 91125579 |
| Molecular Formula | C10H16O8 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | [(2R,3S,4S,6R)-4-acetyloxy-5,5,6-trihydroxy-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](C)O[C@@H](O)C(O)(O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C10H16O8/c1-4-7(17-5(2)11)8(18-6(3)12)10(14,15)9(13)16-4/h4,7-9,13-15H,1-3H3/t4-,7+,8+,9-/m1/s1 |
| InChIKey | LAFYTZPDEJPPOY-CYAXSCHPSA-N |
| XLogP | -1.73 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|