C13H16BrFO9 — CID 130330879
methyl (3S,5S,6S)-3,4,5-triacetyloxy-2-bromo-6-fluorooxane-2-carboxylate (PubChem CID 130330879) has the molecular formula C13H16BrFO9 and a molecular weight of 415.16 g/mol. Its IUPAC name is methyl (3S,5S,6S)-3,4,5-triacetyloxy-2-bromo-6-fluorooxane-2-carboxylate.
| Compound Name | methyl (3S,5S,6S)-3,4,5-triacetyloxy-2-bromo-6-fluorooxane-2-carboxylate |
|---|---|
| PubChem CID | 130330879 |
| Molecular Formula | C13H16BrFO9 |
| Molecular Weight | 415.16 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | methyl (3S,5S,6S)-3,4,5-triacetyloxy-2-bromo-6-fluorooxane-2-carboxylate |
| SMILES | COC(=O)C1(Br)O[C@@H](F)[C@@H](OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H16BrFO9/c1-5(16)21-8-9(22-6(2)17)11(15)24-13(14,12(19)20-4)10(8)23-7(3)18/h8-11H,1-4H3/t8?,9-,10-,11+,13?/m0/s1 |
| InChIKey | YSHQQHOFHXHXOT-RMQVTFPSSA-N |
| XLogP | 0.37 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.16 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|