C18H25BrO13S — CID 102281285
methyl 3-[(2S,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)-6-bromooxan-2-yl]sulfonylpropanoate (PubChem CID 102281285) has the molecular formula C18H25BrO13S and a molecular weight of 561.36 g/mol. Its IUPAC name is methyl 3-[(2S,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)-6-bromooxan-2-yl]sulfonylpropanoate.
| Compound Name | methyl 3-[(2S,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)-6-bromooxan-2-yl]sulfonylpropanoate |
|---|---|
| PubChem CID | 102281285 |
| Molecular Formula | C18H25BrO13S |
| Molecular Weight | 561.36 g/mol |
| Exact Mass | 560.02 |
| IUPAC Name | methyl 3-[(2S,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)-6-bromooxan-2-yl]sulfonylpropanoate |
| SMILES | COC(=O)CCS(=O)(=O)[C@@H]1O[C@](Br)(COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H25BrO13S/c1-9(20)28-8-18(19)16(31-12(4)23)14(29-10(2)21)15(30-11(3)22)17(32-18)33(25,26)7-6-13(24)27-5/h14-17H,6-8H2,1-5H3/t14-,15-,16+,17+,18-/m1/s1 |
| InChIKey | BQWDIDBKZPJGIJ-DFBDCSAJSA-N |
| XLogP | -0.23 |
| TPSA | 174.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.36 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|