C16H23NO10 — CID 10362888
[(1S,2S,3R,4S,5S)-2-acetamido-3,4,5-triacetyloxy-1-hydroxycyclopentyl]methyl acetate (PubChem CID 10362888) has the molecular formula C16H23NO10 and a molecular weight of 389.36 g/mol. Its IUPAC name is [(1S,2S,3R,4S,5S)-2-acetamido-3,4,5-triacetyloxy-1-hydroxycyclopentyl]methyl acetate.
| Compound Name | [(1S,2S,3R,4S,5S)-2-acetamido-3,4,5-triacetyloxy-1-hydroxycyclopentyl]methyl acetate |
|---|---|
| PubChem CID | 10362888 |
| Molecular Formula | C16H23NO10 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | [(1S,2S,3R,4S,5S)-2-acetamido-3,4,5-triacetyloxy-1-hydroxycyclopentyl]methyl acetate |
| SMILES | CC(=O)N[C@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@]1(O)COC(C)=O |
| InChI | InChI=1S/C16H23NO10/c1-7(18)17-14-12(25-9(3)20)13(26-10(4)21)15(27-11(5)22)16(14,23)6-24-8(2)19/h12-15,23H,6H2,1-5H3,(H,17,18)/t12-,13-,14-,15-,16+/m0/s1 |
| InChIKey | QNCRSNOXZJISBY-UVPYHEFZSA-N |
| XLogP | -1.41 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|