C28H39NO18 — CID 10996010
[(2R,3S,4S,5R,6R)-4-acetamido-3,5-diacetyloxy-6-[(2S,3S,4R,5R)-3,4-diacetyloxy-2,5-bis(acetyloxymethyl)oxolan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 10996010) has the molecular formula C28H39NO18 and a molecular weight of 677.61 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-4-acetamido-3,5-diacetyloxy-6-[(2S,3S,4R,5R)-3,4-diacetyloxy-2,5-bis(acetyloxymethyl)oxolan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-4-acetamido-3,5-diacetyloxy-6-[(2S,3S,4R,5R)-3,4-diacetyloxy-2,5-bis(acetyloxymethyl)oxolan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10996010 |
| Molecular Formula | C28H39NO18 |
| Molecular Weight | 677.61 g/mol |
| Exact Mass | 677.22 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-4-acetamido-3,5-diacetyloxy-6-[(2S,3S,4R,5R)-3,4-diacetyloxy-2,5-bis(acetyloxymethyl)oxolan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@@H](O[C@]2(COC(C)=O)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(C)=O)O[C@H](COC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H39NO18/c1-12(30)29-22-23(41-16(5)34)20(9-38-13(2)31)45-27(25(22)43-18(7)36)47-28(11-40-15(4)33)26(44-19(8)37)24(42-17(6)35)21(46-28)10-39-14(3)32/h20-27H,9-11H2,1-8H3,(H,29,30)/t20-,21-,22+,23-,24-,25-,26+,27-,28+/m1/s1 |
| InChIKey | VAAFPITYMPLCFE-JBVYEJEQSA-N |
| XLogP | -1.26 |
| TPSA | 240.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.61 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|