C25H35NO16 — CID 14754763
methyl (2S,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(acetyloxymethyl)-6-[(1R,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 14754763) has the molecular formula C25H35NO16 and a molecular weight of 605.55 g/mol. Its IUPAC name is methyl (2S,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(acetyloxymethyl)-6-[(1R,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(acetyloxymethyl)-6-[(1R,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 14754763 |
| Molecular Formula | C25H35NO16 |
| Molecular Weight | 605.55 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | methyl (2S,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-(acetyloxymethyl)-6-[(1R,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@](COC(C)=O)([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)[C@H](NC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H35NO16/c1-11(27)26-22-20(40-16(6)32)19(39-15(5)31)21(24(34)35-8)42-25(22,10-37-13(3)29)23(41-17(7)33)18(38-14(4)30)9-36-12(2)28/h18-23H,9-10H2,1-8H3,(H,26,27)/t18-,19+,20+,21+,22-,23-,25-/m1/s1 |
| InChIKey | NKTXJWXTSSVPIR-DBTQVZPLSA-N |
| XLogP | -1.35 |
| TPSA | 222.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.55 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|