C12H23NO4S — CID 79848100
methyl 3-(2-amino-3,3-dimethylcyclohexyl)sulfonylpropanoate (PubChem CID 79848100) has the molecular formula C12H23NO4S and a molecular weight of 277.39 g/mol. Its IUPAC name is methyl 3-(2-amino-3,3-dimethylcyclohexyl)sulfonylpropanoate.
| Compound Name | methyl 3-(2-amino-3,3-dimethylcyclohexyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 79848100 |
| Molecular Formula | C12H23NO4S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | methyl 3-(2-amino-3,3-dimethylcyclohexyl)sulfonylpropanoate |
| SMILES | COC(=O)CCS(=O)(=O)C1CCCC(C)(C)C1N |
| InChI | InChI=1S/C12H23NO4S/c1-12(2)7-4-5-9(11(12)13)18(15,16)8-6-10(14)17-3/h9,11H,4-8,13H2,1-3H3 |
| InChIKey | QEWDPBUMUNCCDJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |