C14H27NO4S — CID 116687561
tert-butyl 2-(2-amino-3,3-dimethylcyclohexyl)sulfonylacetate (PubChem CID 116687561) has the molecular formula C14H27NO4S and a molecular weight of 305.44 g/mol. Its IUPAC name is tert-butyl 2-(2-amino-3,3-dimethylcyclohexyl)sulfonylacetate.
| Compound Name | tert-butyl 2-(2-amino-3,3-dimethylcyclohexyl)sulfonylacetate |
|---|---|
| PubChem CID | 116687561 |
| Molecular Formula | C14H27NO4S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | tert-butyl 2-(2-amino-3,3-dimethylcyclohexyl)sulfonylacetate |
| SMILES | CC(C)(C)OC(=O)CS(=O)(=O)C1CCCC(C)(C)C1N |
| InChI | InChI=1S/C14H27NO4S/c1-13(2,3)19-11(16)9-20(17,18)10-7-6-8-14(4,5)12(10)15/h10,12H,6-9,15H2,1-5H3 |
| InChIKey | NKUIOVABDCPZNT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |