C11H21NO4S — CID 79847225
methyl 2-(2-amino-3,3-dimethylcyclohexyl)sulfonylacetate (PubChem CID 79847225) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is methyl 2-(2-amino-3,3-dimethylcyclohexyl)sulfonylacetate.
| Compound Name | methyl 2-(2-amino-3,3-dimethylcyclohexyl)sulfonylacetate |
|---|---|
| PubChem CID | 79847225 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | methyl 2-(2-amino-3,3-dimethylcyclohexyl)sulfonylacetate |
| SMILES | COC(=O)CS(=O)(=O)C1CCCC(C)(C)C1N |
| InChI | InChI=1S/C11H21NO4S/c1-11(2)6-4-5-8(10(11)12)17(14,15)7-9(13)16-3/h8,10H,4-7,12H2,1-3H3 |
| InChIKey | ZFCWZEFVTSYYHR-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |