C9H19NO2S — CID 79847216
2,2-dimethyl-6-methylsulfonylcyclohexan-1-amine (PubChem CID 79847216) has the molecular formula C9H19NO2S and a molecular weight of 205.32 g/mol. Its IUPAC name is 2,2-dimethyl-6-methylsulfonylcyclohexan-1-amine.
| Compound Name | 2,2-dimethyl-6-methylsulfonylcyclohexan-1-amine |
|---|---|
| PubChem CID | 79847216 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2,2-dimethyl-6-methylsulfonylcyclohexan-1-amine |
| SMILES | CC1(C)CCCC(S(C)(=O)=O)C1N |
| InChI | InChI=1S/C9H19NO2S/c1-9(2)6-4-5-7(8(9)10)13(3,11)12/h7-8H,4-6,10H2,1-3H3 |
| InChIKey | QBRWKGTYVXAYOA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |