C13H25NO2S — CID 79863453
5-cyclohexylsulfonyl-2,2-dimethylcyclopentan-1-amine (PubChem CID 79863453) has the molecular formula C13H25NO2S and a molecular weight of 259.41 g/mol. Its IUPAC name is 5-cyclohexylsulfonyl-2,2-dimethylcyclopentan-1-amine.
| Compound Name | 5-cyclohexylsulfonyl-2,2-dimethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 79863453 |
| Molecular Formula | C13H25NO2S |
| Molecular Weight | 259.41 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 5-cyclohexylsulfonyl-2,2-dimethylcyclopentan-1-amine |
| SMILES | CC1(C)CCC(S(=O)(=O)C2CCCCC2)C1N |
| InChI | InChI=1S/C13H25NO2S/c1-13(2)9-8-11(12(13)14)17(15,16)10-6-4-3-5-7-10/h10-12H,3-9,14H2,1-2H3 |
| InChIKey | WDVYTIZXVSZZGY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |