C12H16BrN3O8 — CID 71150166
[(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-(azidomethyl)-6-bromo-6-hydroxyoxan-3-yl] acetate (PubChem CID 71150166) has the molecular formula C12H16BrN3O8 and a molecular weight of 410.18 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-(azidomethyl)-6-bromo-6-hydroxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-(azidomethyl)-6-bromo-6-hydroxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 71150166 |
| Molecular Formula | C12H16BrN3O8 |
| Molecular Weight | 410.18 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-2-(azidomethyl)-6-bromo-6-hydroxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](CN=[N+]=[N-])O[C@@](O)(Br)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C12H16BrN3O8/c1-5(17)21-9-8(4-15-16-14)24-12(13,20)11(23-7(3)19)10(9)22-6(2)18/h8-11,20H,4H2,1-3H3/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | VMXDTCDDGGZPHX-RMPHRYRLSA-N |
| XLogP | 0.53 |
| TPSA | 157.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|