C13H19N3O8 — CID 90470197
[(2R,3R,4S,5S)-4-acetyloxy-5-(1-acetyloxyethyl)-2-(azidomethyl)-5-hydroxyoxolan-3-yl] acetate (PubChem CID 90470197) has the molecular formula C13H19N3O8 and a molecular weight of 345.31 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-4-acetyloxy-5-(1-acetyloxyethyl)-2-(azidomethyl)-5-hydroxyoxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S)-4-acetyloxy-5-(1-acetyloxyethyl)-2-(azidomethyl)-5-hydroxyoxolan-3-yl] acetate |
|---|---|
| PubChem CID | 90470197 |
| Molecular Formula | C13H19N3O8 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | [(2R,3R,4S,5S)-4-acetyloxy-5-(1-acetyloxyethyl)-2-(azidomethyl)-5-hydroxyoxolan-3-yl] acetate |
| SMILES | CC(=O)OC(C)[C@]1(O)O[C@H](CN=[N+]=[N-])[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H19N3O8/c1-6(21-7(2)17)13(20)12(23-9(4)19)11(22-8(3)18)10(24-13)5-15-16-14/h6,10-12,20H,5H2,1-4H3/t6?,10-,11-,12+,13+/m1/s1 |
| InChIKey | VUIXCYPPYJEKEA-AINIPBITSA-N |
| XLogP | 0.20 |
| TPSA | 157.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|