C28H40O6 — CID 101288170
[(1R,9R,19R,21R)-3,6,6,11,11,18,18,21-octamethyl-5,7,10,12-tetraoxahexacyclo[14.5.1.01,8.04,8.09,14.017,19]docosa-2,14-dien-22-yl] acetate (PubChem CID 101288170) has the molecular formula C28H40O6 and a molecular weight of 472.62 g/mol. Its IUPAC name is [(1R,9R,19R,21R)-3,6,6,11,11,18,18,21-octamethyl-5,7,10,12-tetraoxahexacyclo[14.5.1.01,8.04,8.09,14.017,19]docosa-2,14-dien-22-yl] acetate.
| Compound Name | [(1R,9R,19R,21R)-3,6,6,11,11,18,18,21-octamethyl-5,7,10,12-tetraoxahexacyclo[14.5.1.01,8.04,8.09,14.017,19]docosa-2,14-dien-22-yl] acetate |
|---|---|
| PubChem CID | 101288170 |
| Molecular Formula | C28H40O6 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | [(1R,9R,19R,21R)-3,6,6,11,11,18,18,21-octamethyl-5,7,10,12-tetraoxahexacyclo[14.5.1.01,8.04,8.09,14.017,19]docosa-2,14-dien-22-yl] acetate |
| SMILES | CC(=O)OC1C2C=C3COC(C)(C)O[C@H]3C34OC(C)(C)OC3C(C)=C[C@]14[C@H](C)C[C@@H]1C2C1(C)C |
| InChI | InChI=1S/C28H40O6/c1-14-12-27-15(2)10-19-20(24(19,4)5)18(23(27)31-16(3)29)11-17-13-30-25(6,7)33-22(17)28(27)21(14)32-26(8,9)34-28/h11-12,15,18-23H,10,13H2,1-9H3/t15-,18?,19-,20?,21?,22-,23?,27+,28?/m1/s1 |
| InChIKey | BBHDLDXGZSTFBP-FLZWGIOCSA-N |
| XLogP | 4.77 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|