C28H40O6 — CID 123855300
(5,19-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl) 3-methylbut-2-enoate (PubChem CID 123855300) has the molecular formula C28H40O6 and a molecular weight of 472.62 g/mol. Its IUPAC name is (5,19-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl) 3-methylbut-2-enoate.
| Compound Name | (5,19-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl) 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 123855300 |
| Molecular Formula | C28H40O6 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | (5,19-dihydroxy-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl) 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OC1C(C)=CC23C(C)CC4C(C(C=C5COC(C)(C)OC5C12O)C3O)C4(C)C |
| InChI | InChI=1S/C28H40O6/c1-14(2)9-20(29)33-23-15(3)12-27-16(4)10-19-21(25(19,5)6)18(22(27)30)11-17-13-32-26(7,8)34-24(17)28(23,27)31/h9,11-12,16,18-19,21-24,30-31H,10,13H2,1-8H3 |
| InChIKey | ALQOXVMTAPIOCM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|