C29H45NO6 — CID 130235266
[(1R,4S,5S,6R,13S,14R,18R)-5,19-dihydroxy-3,8,8,15,15,16,18-heptamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl] N,N-diethylcarbamate (PubChem CID 130235266) has the molecular formula C29H45NO6 and a molecular weight of 503.68 g/mol. Its IUPAC name is [(1R,4S,5S,6R,13S,14R,18R)-5,19-dihydroxy-3,8,8,15,15,16,18-heptamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl] N,N-diethylcarbamate.
| Compound Name | [(1R,4S,5S,6R,13S,14R,18R)-5,19-dihydroxy-3,8,8,15,15,16,18-heptamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 130235266 |
| Molecular Formula | C29H45NO6 |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.32 |
| IUPAC Name | [(1R,4S,5S,6R,13S,14R,18R)-5,19-dihydroxy-3,8,8,15,15,16,18-heptamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,11-dien-4-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)O[C@@H]1C(C)=C[C@]23C(O)[C@@H](C=C4COC(C)(C)O[C@H]4[C@]12O)[C@@H]1C(C)(C)C1(C)C[C@H]3C |
| InChI | InChI=1S/C29H45NO6/c1-10-30(11-2)24(32)35-22-16(3)13-28-17(4)14-27(9)20(25(27,5)6)19(21(28)31)12-18-15-34-26(7,8)36-23(18)29(22,28)33/h12-13,17,19-23,31,33H,10-11,14-15H2,1-9H3/t17-,19+,20-,21?,22-,23-,27?,28+,29-/m1/s1 |
| InChIKey | KJPASZHYXOQMMP-ONWLTVAASA-N |
| XLogP | 4.28 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|