C12H19ClO3 — CID 23268323
[(1R,2R,3R,4R,6S)-4-chloro-3-hydroxy-4,7,7-trimethyl-2-bicyclo[4.1.0]heptanyl] acetate (PubChem CID 23268323) has the molecular formula C12H19ClO3 and a molecular weight of 246.73 g/mol. Its IUPAC name is [(1R,2R,3R,4R,6S)-4-chloro-3-hydroxy-4,7,7-trimethyl-2-bicyclo[4.1.0]heptanyl] acetate.
| Compound Name | [(1R,2R,3R,4R,6S)-4-chloro-3-hydroxy-4,7,7-trimethyl-2-bicyclo[4.1.0]heptanyl] acetate |
|---|---|
| PubChem CID | 23268323 |
| Molecular Formula | C12H19ClO3 |
| Molecular Weight | 246.73 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | [(1R,2R,3R,4R,6S)-4-chloro-3-hydroxy-4,7,7-trimethyl-2-bicyclo[4.1.0]heptanyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2[C@H](C[C@@](C)(Cl)[C@@H]1O)C2(C)C |
| InChI | InChI=1S/C12H19ClO3/c1-6(14)16-9-8-7(11(8,2)3)5-12(4,13)10(9)15/h7-10,15H,5H2,1-4H3/t7-,8-,9+,10+,12+/m0/s1 |
| InChIKey | OEBREZQZEQZWNK-DSPMHBFJSA-N |
| XLogP | 1.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.73 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|