About (4-methyl-9-pentacyclo[4.3.0.02,4.03,8.05,7]nonanyl) acetate
(4-methyl-9-pentacyclo[4.3.0.02,4.03,8.05,7]nonanyl) acetate (PubChem CID 131855065) has the molecular formula C12H14O2
and a molecular weight of 190.24 g/mol. Its IUPAC name is (4-methyl-9-pentacyclo[4.3.0.02,4.03,8.05,7]nonanyl) acetate.
Analyze (4-methyl-9-pentacyclo[4.3.0.02,4.03,8.05,7]nonanyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-9-pentacyclo[4.3.0.02,4.03,8.05,7]nonanyl) acetate?
The IUPAC name of (4-methyl-9-pentacyclo[4.3.0.02,4.03,8.05,7]nonanyl) acetate (CID 131855065) is (4-methyl-9-pentacyclo[4.3.0.02,4.03,8.05,7]nonanyl) acetate.
What is the SMILES notation for (4-methyl-9-pentacyclo[4.3.0.02,4.03,8.05,7]nonanyl) acetate?
The canonical SMILES for (4-methyl-9-pentacyclo[4.3.0.02,4.03,8.05,7]nonanyl) acetate is CC(=O)OC1C2C3C4C1C1C2C1(C)C34.
What is the InChIKey of (4-methyl-9-pentacyclo[4.3.0.02,4.03,8.05,7]nonanyl) acetate?
The InChIKey is APXCHOULAIGMPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2/c1-3(13)14-11-6-4-5-7(11)10-9(6)12(10,2)8(4)5/h4-11H,1-2H3.
What are the key properties of (4-methyl-9-pentacyclo[4.3.0.02,4.03,8.05,7]nonanyl) acetate?
(4-methyl-9-pentacyclo[4.3.0.02,4.03,8.05,7]nonanyl) acetate has a molecular weight of 190.24 g/mol, XLogP of 1.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-9-pentacyclo[4.3.0.02,4.03,8.05,7]nonanyl) acetate is sourced from PubChem (CID 131855065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).