C12H20O3 — CID 15375852
[(1S,3R)-3-acetyl-3,4,4-trimethylcyclopentyl] acetate (PubChem CID 15375852) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is [(1S,3R)-3-acetyl-3,4,4-trimethylcyclopentyl] acetate.
| Compound Name | [(1S,3R)-3-acetyl-3,4,4-trimethylcyclopentyl] acetate |
|---|---|
| PubChem CID | 15375852 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | [(1S,3R)-3-acetyl-3,4,4-trimethylcyclopentyl] acetate |
| SMILES | CC(=O)O[C@H]1CC(C)(C)[C@](C)(C(C)=O)C1 |
| InChI | InChI=1S/C12H20O3/c1-8(13)12(5)7-10(15-9(2)14)6-11(12,3)4/h10H,6-7H2,1-5H3/t10-,12-/m0/s1 |
| InChIKey | WSBPWOXDDDHLLA-JQWIXIFHSA-N |
| XLogP | 2.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |