C16H26O5 — CID 10614027
[4-[(1R,4S)-4-acetyloxy-1,2,2-trimethylcyclopentyl]-4-oxobutyl] acetate (PubChem CID 10614027) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is [4-[(1R,4S)-4-acetyloxy-1,2,2-trimethylcyclopentyl]-4-oxobutyl] acetate.
| Compound Name | [4-[(1R,4S)-4-acetyloxy-1,2,2-trimethylcyclopentyl]-4-oxobutyl] acetate |
|---|---|
| PubChem CID | 10614027 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [4-[(1R,4S)-4-acetyloxy-1,2,2-trimethylcyclopentyl]-4-oxobutyl] acetate |
| SMILES | CC(=O)OCCCC(=O)[C@]1(C)C[C@@H](OC(C)=O)CC1(C)C |
| InChI | InChI=1S/C16H26O5/c1-11(17)20-8-6-7-14(19)16(5)10-13(21-12(2)18)9-15(16,3)4/h13H,6-10H2,1-5H3/t13-,16-/m0/s1 |
| InChIKey | IXLAABFLACPCPD-BBRMVZONSA-N |
| XLogP | 2.66 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|