C6H13NO — CID 97300410
cis-(1S,3R)-3-amino-2,2-dimethylcyclobutan-1-ol (PubChem CID 97300410) has the molecular formula C6H13NO and a molecular weight of 115.18 g/mol. Its IUPAC name is cis-(1S,3R)-3-amino-2,2-dimethylcyclobutan-1-ol.
| Compound Name | cis-(1S,3R)-3-amino-2,2-dimethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 97300410 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | cis-(1S,3R)-3-amino-2,2-dimethylcyclobutan-1-ol |
| SMILES | CC1(C)[C@H](N)C[C@@H]1O |
| InChI | InChI=1S/C6H13NO/c1-6(2)4(7)3-5(6)8/h4-5,8H,3,7H2,1-2H3/t4-,5+/m1/s1 |
| InChIKey | MLXIQOVWRZVXSV-UHNVWZDZSA-N |
| XLogP | 0.10 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |