C7H15N3O — CID 114630033
2-(3-hydroxy-2,2-dimethylcyclobutyl)guanidine (PubChem CID 114630033) has the molecular formula C7H15N3O and a molecular weight of 157.22 g/mol. Its IUPAC name is 2-(3-hydroxy-2,2-dimethylcyclobutyl)guanidine.
| Compound Name | 2-(3-hydroxy-2,2-dimethylcyclobutyl)guanidine |
|---|---|
| PubChem CID | 114630033 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | 2-(3-hydroxy-2,2-dimethylcyclobutyl)guanidine |
| SMILES | CC1(C)C(O)CC1N=C(N)N |
| InChI | InChI=1S/C7H15N3O/c1-7(2)4(3-5(7)11)10-6(8)9/h4-5,11H,3H2,1-2H3,(H4,8,9,10) |
| InChIKey | VYPNJJSVKDBCEG-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|