C11H23N3O — CID 111824177
2-(3-ethoxy-2,2-diethylcyclobutyl)guanidine (PubChem CID 111824177) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-(3-ethoxy-2,2-diethylcyclobutyl)guanidine.
| Compound Name | 2-(3-ethoxy-2,2-diethylcyclobutyl)guanidine |
|---|---|
| PubChem CID | 111824177 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 2-(3-ethoxy-2,2-diethylcyclobutyl)guanidine |
| SMILES | CCOC1CC(N=C(N)N)C1(CC)CC |
| InChI | InChI=1S/C11H23N3O/c1-4-11(5-2)8(14-10(12)13)7-9(11)15-6-3/h8-9H,4-7H2,1-3H3,(H4,12,13,14) |
| InChIKey | ZNVVHBKYNDRANB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|