C17H25N3O3 — CID 119146326
2-N-(3-ethoxy-2,2-diethylcyclobutyl)pyridine-2,5-dicarboxamide (PubChem CID 119146326) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-N-(3-ethoxy-2,2-diethylcyclobutyl)pyridine-2,5-dicarboxamide.
| Compound Name | 2-N-(3-ethoxy-2,2-diethylcyclobutyl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 119146326 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 2-N-(3-ethoxy-2,2-diethylcyclobutyl)pyridine-2,5-dicarboxamide |
| SMILES | CCOC1CC(NC(=O)c2ccc(C(N)=O)cn2)C1(CC)CC |
| InChI | InChI=1S/C17H25N3O3/c1-4-17(5-2)13(9-14(17)23-6-3)20-16(22)12-8-7-11(10-19-12)15(18)21/h7-8,10,13-14H,4-6,9H2,1-3H3,(H2,18,21)(H,20,22) |
| InChIKey | UJVIRJMKINYIHI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |