About 6-amino-N-(3-ethoxy-2,2-dimethylcyclobutyl)pyridine-2-carboxamide
6-amino-N-(3-ethoxy-2,2-dimethylcyclobutyl)pyridine-2-carboxamide (PubChem CID 103832164) has the molecular formula C14H21N3O2
and a molecular weight of 263.34 g/mol. Its IUPAC name is 6-amino-N-(3-ethoxy-2,2-dimethylcyclobutyl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 6-amino-N-(3-ethoxy-2,2-dimethylcyclobutyl)pyridine-2-carboxamide |
| PubChem CID | 103832164 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 6-amino-N-(3-ethoxy-2,2-dimethylcyclobutyl)pyridine-2-carboxamide |
| SMILES | CCOC1CC(NC(=O)c2cccc(N)n2)C1(C)C |
| InChI | InChI=1S/C14H21N3O2/c1-4-19-11-8-10(14(11,2)3)17-13(18)9-6-5-7-12(15)16-9/h5-7,10-11H,4,8H2,1-3H3,(H2,15,16)(H,17,18) |
| InChIKey | BKEAZOGEOFJPPS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-amino-N-(3-ethoxy-2,2-dimethylcyclobutyl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-N-(3-ethoxy-2,2-dimethylcyclobutyl)pyridine-2-carboxamide?
The IUPAC name of 6-amino-N-(3-ethoxy-2,2-dimethylcyclobutyl)pyridine-2-carboxamide (CID 103832164) is 6-amino-N-(3-ethoxy-2,2-dimethylcyclobutyl)pyridine-2-carboxamide.
What is the SMILES notation for 6-amino-N-(3-ethoxy-2,2-dimethylcyclobutyl)pyridine-2-carboxamide?
The canonical SMILES for 6-amino-N-(3-ethoxy-2,2-dimethylcyclobutyl)pyridine-2-carboxamide is CCOC1CC(NC(=O)c2cccc(N)n2)C1(C)C.
What is the InChIKey of 6-amino-N-(3-ethoxy-2,2-dimethylcyclobutyl)pyridine-2-carboxamide?
The InChIKey is BKEAZOGEOFJPPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O2/c1-4-19-11-8-10(14(11,2)3)17-13(18)9-6-5-7-12(15)16-9/h5-7,10-11H,4,8H2,1-3H3,(H2,15,16)(H,17,18).
What are the key properties of 6-amino-N-(3-ethoxy-2,2-dimethylcyclobutyl)pyridine-2-carboxamide?
6-amino-N-(3-ethoxy-2,2-dimethylcyclobutyl)pyridine-2-carboxamide has a molecular weight of 263.34 g/mol, XLogP of 1.60, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-N-(3-ethoxy-2,2-dimethylcyclobutyl)pyridine-2-carboxamide is sourced from PubChem (CID 103832164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).