C13H18ClNO3 — CID 113239526
5-chloro-N-(3-ethoxy-2,2-dimethylcyclobutyl)furan-2-carboxamide (PubChem CID 113239526) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is 5-chloro-N-(3-ethoxy-2,2-dimethylcyclobutyl)furan-2-carboxamide.
| Compound Name | 5-chloro-N-(3-ethoxy-2,2-dimethylcyclobutyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 113239526 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 5-chloro-N-(3-ethoxy-2,2-dimethylcyclobutyl)furan-2-carboxamide |
| SMILES | CCOC1CC(NC(=O)c2ccc(Cl)o2)C1(C)C |
| InChI | InChI=1S/C13H18ClNO3/c1-4-17-10-7-9(13(10,2)3)15-12(16)8-5-6-11(14)18-8/h5-6,9-10H,4,7H2,1-3H3,(H,15,16) |
| InChIKey | FRERSURCZUQVQI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |