C18H27NO5 — CID 100610935
5-(dimethoxymethyl)-N-[(1S,3R)-3-ethoxyspiro[3.4]octan-1-yl]furan-2-carboxamide (PubChem CID 100610935) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is 5-(dimethoxymethyl)-N-[(1S,3R)-3-ethoxyspiro[3.4]octan-1-yl]furan-2-carboxamide.
| Compound Name | 5-(dimethoxymethyl)-N-[(1S,3R)-3-ethoxyspiro[3.4]octan-1-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 100610935 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 5-(dimethoxymethyl)-N-[(1S,3R)-3-ethoxyspiro[3.4]octan-1-yl]furan-2-carboxamide |
| SMILES | CCO[C@@H]1C[C@H](NC(=O)c2ccc(C(OC)OC)o2)C12CCCC2 |
| InChI | InChI=1S/C18H27NO5/c1-4-23-15-11-14(18(15)9-5-6-10-18)19-16(20)12-7-8-13(24-12)17(21-2)22-3/h7-8,14-15,17H,4-6,9-11H2,1-3H3,(H,19,20)/t14-,15+/m0/s1 |
| InChIKey | OCUDVIMVYRLTAI-LSDHHAIUSA-N |
| XLogP | 3.04 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|