C20H27NO5 — CID 119186774
2-[3-[(3-ethoxyspiro[3.5]nonan-1-yl)carbamoyl]phenoxy]acetic acid (PubChem CID 119186774) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-[3-[(3-ethoxyspiro[3.5]nonan-1-yl)carbamoyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[(3-ethoxyspiro[3.5]nonan-1-yl)carbamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119186774 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 2-[3-[(3-ethoxyspiro[3.5]nonan-1-yl)carbamoyl]phenoxy]acetic acid |
| SMILES | CCOC1CC(NC(=O)c2cccc(OCC(=O)O)c2)C12CCCCC2 |
| InChI | InChI=1S/C20H27NO5/c1-2-25-17-12-16(20(17)9-4-3-5-10-20)21-19(24)14-7-6-8-15(11-14)26-13-18(22)23/h6-8,11,16-17H,2-5,9-10,12-13H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | VJMLHUGQDQAILA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |