C16H21NO3 — CID 65295482
3-[(3-ethoxyspiro[3.3]heptan-1-yl)amino]benzoic acid (PubChem CID 65295482) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-[(3-ethoxyspiro[3.3]heptan-1-yl)amino]benzoic acid.
| Compound Name | 3-[(3-ethoxyspiro[3.3]heptan-1-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 65295482 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 3-[(3-ethoxyspiro[3.3]heptan-1-yl)amino]benzoic acid |
| SMILES | CCOC1CC(Nc2cccc(C(=O)O)c2)C12CCC2 |
| InChI | InChI=1S/C16H21NO3/c1-2-20-14-10-13(16(14)7-4-8-16)17-12-6-3-5-11(9-12)15(18)19/h3,5-6,9,13-14,17H,2,4,7-8,10H2,1H3,(H,18,19) |
| InChIKey | HQXAQFUBPPCCME-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |