C16H20FNO3 — CID 65294954
3-[(3-ethoxyspiro[3.3]heptan-1-yl)amino]-4-fluorobenzoic acid (PubChem CID 65294954) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is 3-[(3-ethoxyspiro[3.3]heptan-1-yl)amino]-4-fluorobenzoic acid.
| Compound Name | 3-[(3-ethoxyspiro[3.3]heptan-1-yl)amino]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 65294954 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 3-[(3-ethoxyspiro[3.3]heptan-1-yl)amino]-4-fluorobenzoic acid |
| SMILES | CCOC1CC(Nc2cc(C(=O)O)ccc2F)C12CCC2 |
| InChI | InChI=1S/C16H20FNO3/c1-2-21-14-9-13(16(14)6-3-7-16)18-12-8-10(15(19)20)4-5-11(12)17/h4-5,8,13-14,18H,2-3,6-7,9H2,1H3,(H,19,20) |
| InChIKey | HGEYOOIRQLSBGF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |