C17H23NO6S — CID 136549077
4-[(3-ethoxyspiro[3.3]heptan-1-yl)sulfamoyl]-3-methoxybenzoic acid (PubChem CID 136549077) has the molecular formula C17H23NO6S and a molecular weight of 369.44 g/mol. Its IUPAC name is 4-[(3-ethoxyspiro[3.3]heptan-1-yl)sulfamoyl]-3-methoxybenzoic acid.
| Compound Name | 4-[(3-ethoxyspiro[3.3]heptan-1-yl)sulfamoyl]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 136549077 |
| Molecular Formula | C17H23NO6S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 4-[(3-ethoxyspiro[3.3]heptan-1-yl)sulfamoyl]-3-methoxybenzoic acid |
| SMILES | CCOC1CC(NS(=O)(=O)c2ccc(C(=O)O)cc2OC)C12CCC2 |
| InChI | InChI=1S/C17H23NO6S/c1-3-24-15-10-14(17(15)7-4-8-17)18-25(21,22)13-6-5-11(16(19)20)9-12(13)23-2/h5-6,9,14-15,18H,3-4,7-8,10H2,1-2H3,(H,19,20) |
| InChIKey | VJLQKTHBBDBPHW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |