C14H20N2O3S — CID 71997395
N-(3-ethoxyspiro[3.3]heptan-1-yl)pyridine-3-sulfonamide (PubChem CID 71997395) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is N-(3-ethoxyspiro[3.3]heptan-1-yl)pyridine-3-sulfonamide.
| Compound Name | N-(3-ethoxyspiro[3.3]heptan-1-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 71997395 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-(3-ethoxyspiro[3.3]heptan-1-yl)pyridine-3-sulfonamide |
| SMILES | CCOC1CC(NS(=O)(=O)c2cccnc2)C12CCC2 |
| InChI | InChI=1S/C14H20N2O3S/c1-2-19-13-9-12(14(13)6-4-7-14)16-20(17,18)11-5-3-8-15-10-11/h3,5,8,10,12-13,16H,2,4,6-7,9H2,1H3 |
| InChIKey | BJGHKXXINVBBFV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |