C17H20N2O3S — CID 95933296
N-[(1S,3R)-3-ethoxyspiro[3.3]heptan-1-yl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide (PubChem CID 95933296) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-[(1S,3R)-3-ethoxyspiro[3.3]heptan-1-yl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-[(1S,3R)-3-ethoxyspiro[3.3]heptan-1-yl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 95933296 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-[(1S,3R)-3-ethoxyspiro[3.3]heptan-1-yl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
| SMILES | CCO[C@@H]1C[C@H](NC(=O)c2ccc3[nH]c(=S)oc3c2)C12CCC2 |
| InChI | InChI=1S/C17H20N2O3S/c1-2-21-14-9-13(17(14)6-3-7-17)19-15(20)10-4-5-11-12(8-10)22-16(23)18-11/h4-5,8,13-14H,2-3,6-7,9H2,1H3,(H,18,23)(H,19,20)/t13-,14+/m0/s1 |
| InChIKey | WEPOGIXLFWMSAL-UONOGXRCSA-N |
| XLogP | 3.57 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|